C26H26BrFN6O3 — CID 166560267
4-[2-[(1R)-1-(5-bromo-2-nitrophenoxy)ethyl]-4-fluorophenyl]-5-[[3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]methyl]-2-methyltriazole (PubChem CID 166560267) has the molecular formula C26H26BrFN6O3 and a molecular weight of 569.44 g/mol. Its IUPAC name is 4-[2-[(1R)-1-(5-bromo-2-nitrophenoxy)ethyl]-4-fluorophenyl]-5-[[3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]methyl]-2-methyltriazole.
| Compound Name | 4-[2-[(1R)-1-(5-bromo-2-nitrophenoxy)ethyl]-4-fluorophenyl]-5-[[3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]methyl]-2-methyltriazole |
|---|---|
| PubChem CID | 166560267 |
| Molecular Formula | C26H26BrFN6O3 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 4-[2-[(1R)-1-(5-bromo-2-nitrophenoxy)ethyl]-4-fluorophenyl]-5-[[3-(cyclopropylmethyl)-1-methylpyrazol-5-yl]methyl]-2-methyltriazole |
| SMILES | C[C@@H](Oc1cc(Br)ccc1[N+](=O)[O-])c1cc(F)ccc1-c1nn(C)nc1Cc1cc(CC2CC2)nn1C |
| InChI | InChI=1S/C26H26BrFN6O3/c1-15(37-25-11-17(27)6-9-24(25)34(35)36)22-12-18(28)7-8-21(22)26-23(30-33(3)31-26)14-20-13-19(29-32(20)2)10-16-4-5-16/h6-9,11-13,15-16H,4-5,10,14H2,1-3H3/t15-/m1/s1 |
| InChIKey | HYMNEHVBSWQBEV-OAHLLOKOSA-N |
| XLogP | 5.71 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|