C20H26N2 — CID 165060976
N-(3-pentyl-5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine (PubChem CID 165060976) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-(3-pentyl-5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine.
| Compound Name | N-(3-pentyl-5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 165060976 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-(3-pentyl-5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine |
| SMILES | CCCCCc1cc2c(c(Nc3ccccn3)c1)CCCC2 |
| InChI | InChI=1S/C20H26N2/c1-2-3-4-9-16-14-17-10-5-6-11-18(17)19(15-16)22-20-12-7-8-13-21-20/h7-8,12-15H,2-6,9-11H2,1H3,(H,21,22) |
| InChIKey | RERUACSRQJXKEU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|