About methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane
methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane (PubChem CID 165061048) has the molecular formula C14H29NO5S
and a molecular weight of 323.46 g/mol. Its IUPAC name is methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane.
Molecular Properties
| Compound Name | methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane |
| PubChem CID | 165061048 |
| Molecular Formula | C14H29NO5S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane |
| SMILES | COC(=O)CC(=O)C(C)C.COC(=O)C[C@H](N)C(C)C.S |
| InChI | InChI=1S/C7H15NO2.C7H12O3.H2S/c2*1-5(2)6(8)4-7(9)10-3;/h5-6H,4,8H2,1-3H3;5H,4H2,1-3H3;1H2/t6-;;/m0../s1 |
| InChIKey | REZCTIMGVCSZNB-ILKKLZGPSA-N |
| XLogP | 1.42 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane?
The IUPAC name of methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane (CID 165061048) is methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane.
What is the SMILES notation for methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane?
The canonical SMILES for methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane is COC(=O)CC(=O)C(C)C.COC(=O)C[C@H](N)C(C)C.S.
What is the InChIKey of methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane?
The InChIKey is REZCTIMGVCSZNB-ILKKLZGPSA-N. The full InChI is InChI=1S/C7H15NO2.C7H12O3.H2S/c2*1-5(2)6(8)4-7(9)10-3;/h5-6H,4,8H2,1-3H3;5H,4H2,1-3H3;1H2/t6-;;/m0../s1.
What are the key properties of methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane?
methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane has a molecular weight of 323.46 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-amino-4-methylpentanoate;methyl 4-methyl-3-oxopentanoate;sulfane is sourced from PubChem (CID 165061048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).