C18H16N4OS — CID 16506211
1-phenyl-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)butan-1-one (PubChem CID 16506211) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-phenyl-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)butan-1-one.
| Compound Name | 1-phenyl-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)butan-1-one |
|---|---|
| PubChem CID | 16506211 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-phenyl-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)butan-1-one |
| SMILES | O=C(CCCSc1n[nH]c2nc3ccccc3n12)c1ccccc1 |
| InChI | InChI=1S/C18H16N4OS/c23-16(13-7-2-1-3-8-13)11-6-12-24-18-21-20-17-19-14-9-4-5-10-15(14)22(17)18/h1-5,7-10H,6,11-12H2,(H,19,20) |
| InChIKey | ZBXPLGWDTYLUOU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|