C16H13FN4S2 — CID 7160511
1-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3H-[1,2,4]triazolo[4,3-a]benzimidazole (PubChem CID 7160511) has the molecular formula C16H13FN4S2 and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3H-[1,2,4]triazolo[4,3-a]benzimidazole.
| Compound Name | 1-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3H-[1,2,4]triazolo[4,3-a]benzimidazole |
|---|---|
| PubChem CID | 7160511 |
| Molecular Formula | C16H13FN4S2 |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3H-[1,2,4]triazolo[4,3-a]benzimidazole |
| SMILES | Fc1ccccc1SCCSc1n[nH]c2nc3ccccc3n12 |
| InChI | InChI=1S/C16H13FN4S2/c17-11-5-1-4-8-14(11)22-9-10-23-16-20-19-15-18-12-6-2-3-7-13(12)21(15)16/h1-8H,9-10H2,(H,18,19) |
| InChIKey | LBKDTESFTKMKGV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|