C21H18FN3O4 — CID 165068624
1-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]ethanone (PubChem CID 165068624) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]ethanone.
| Compound Name | 1-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 165068624 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]ethanone |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(C)=O)cc4)no3)c2cc1F |
| InChI | InChI=1S/C21H18FN3O4/c1-12(26)13-3-5-14(6-4-13)17-10-20(29-25-17)21-15-9-16(22)19(28-8-7-27-2)11-18(15)23-24-21/h3-6,9-11H,7-8H2,1-2H3,(H,23,24) |
| InChIKey | SJNWDHRCRBWNNH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|