C29H46N2O4 — CID 165069723
N'-(cyclohexylmethyl)-2-ethyl-6-(6-hydroxy-4-methyl-5-oxohexyl)-N-phenylheptanediamide (PubChem CID 165069723) has the molecular formula C29H46N2O4 and a molecular weight of 486.70 g/mol. Its IUPAC name is N'-(cyclohexylmethyl)-2-ethyl-6-(6-hydroxy-4-methyl-5-oxohexyl)-N-phenylheptanediamide.
| Compound Name | N'-(cyclohexylmethyl)-2-ethyl-6-(6-hydroxy-4-methyl-5-oxohexyl)-N-phenylheptanediamide |
|---|---|
| PubChem CID | 165069723 |
| Molecular Formula | C29H46N2O4 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | N'-(cyclohexylmethyl)-2-ethyl-6-(6-hydroxy-4-methyl-5-oxohexyl)-N-phenylheptanediamide |
| SMILES | CCC(CCCC(CCCC(C)C(=O)CO)C(=O)NCC1CCCCC1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H46N2O4/c1-3-24(29(35)31-26-18-8-5-9-19-26)15-11-17-25(16-10-12-22(2)27(33)21-32)28(34)30-20-23-13-6-4-7-14-23/h5,8-9,18-19,22-25,32H,3-4,6-7,10-17,20-21H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | SOEMLGCMUHRHKT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |