C19H15Cl2N3O2S — CID 165073098
3-chloro-N-[4-[3-(4-chlorophenyl)butanoyl]thiadiazol-5-yl]benzamide (PubChem CID 165073098) has the molecular formula C19H15Cl2N3O2S and a molecular weight of 420.32 g/mol. Its IUPAC name is 3-chloro-N-[4-[3-(4-chlorophenyl)butanoyl]thiadiazol-5-yl]benzamide.
| Compound Name | 3-chloro-N-[4-[3-(4-chlorophenyl)butanoyl]thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 165073098 |
| Molecular Formula | C19H15Cl2N3O2S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 3-chloro-N-[4-[3-(4-chlorophenyl)butanoyl]thiadiazol-5-yl]benzamide |
| SMILES | CC(CC(=O)c1nnsc1NC(=O)c1cccc(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15Cl2N3O2S/c1-11(12-5-7-14(20)8-6-12)9-16(25)17-19(27-24-23-17)22-18(26)13-3-2-4-15(21)10-13/h2-8,10-11H,9H2,1H3,(H,22,26) |
| InChIKey | TVYLQLMIFBODMI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |