C19H16Cl2N4O2S — CID 155256824
5-[(3-chlorobenzoyl)amino]-N-[2-(3-chlorophenyl)propan-2-yl]thiadiazole-4-carboxamide (PubChem CID 155256824) has the molecular formula C19H16Cl2N4O2S and a molecular weight of 435.34 g/mol. Its IUPAC name is 5-[(3-chlorobenzoyl)amino]-N-[2-(3-chlorophenyl)propan-2-yl]thiadiazole-4-carboxamide.
| Compound Name | 5-[(3-chlorobenzoyl)amino]-N-[2-(3-chlorophenyl)propan-2-yl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 155256824 |
| Molecular Formula | C19H16Cl2N4O2S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 5-[(3-chlorobenzoyl)amino]-N-[2-(3-chlorophenyl)propan-2-yl]thiadiazole-4-carboxamide |
| SMILES | CC(C)(NC(=O)c1nnsc1NC(=O)c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N4O2S/c1-19(2,12-6-4-8-14(21)10-12)23-17(27)15-18(28-25-24-15)22-16(26)11-5-3-7-13(20)9-11/h3-10H,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | HPWHNDFJZREUQH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |