C23H28Cl2N2O2S — CID 155717382
(Z)-2-amino-N-[2-(3-chlorophenyl)propan-2-yl]-3-sulfanylbut-2-enamide;1-(3-chlorophenyl)-2-methylpropan-1-one (PubChem CID 155717382) has the molecular formula C23H28Cl2N2O2S and a molecular weight of 467.46 g/mol. Its IUPAC name is (Z)-2-amino-N-[2-(3-chlorophenyl)propan-2-yl]-3-sulfanylbut-2-enamide;1-(3-chlorophenyl)-2-methylpropan-1-one.
| Compound Name | (Z)-2-amino-N-[2-(3-chlorophenyl)propan-2-yl]-3-sulfanylbut-2-enamide;1-(3-chlorophenyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 155717382 |
| Molecular Formula | C23H28Cl2N2O2S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (Z)-2-amino-N-[2-(3-chlorophenyl)propan-2-yl]-3-sulfanylbut-2-enamide;1-(3-chlorophenyl)-2-methylpropan-1-one |
| SMILES | C/C(S)=C(/N)C(=O)NC(C)(C)c1cccc(Cl)c1.CC(C)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2OS.C10H11ClO/c1-8(18)11(15)12(17)16-13(2,3)9-5-4-6-10(14)7-9;1-7(2)10(12)8-4-3-5-9(11)6-8/h4-7,18H,15H2,1-3H3,(H,16,17);3-7H,1-2H3/b11-8-; |
| InChIKey | VQCLWTPYGGVNDP-MKFZHGHUSA-N |
| XLogP | 5.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|