C33H48N6O5 — CID 165076394
1-[4-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]piperazin-1-yl]-7-[2-(3-oxobutoxy)ethoxy]heptane-1,4-dione (PubChem CID 165076394) has the molecular formula C33H48N6O5 and a molecular weight of 608.78 g/mol. Its IUPAC name is 1-[4-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]piperazin-1-yl]-7-[2-(3-oxobutoxy)ethoxy]heptane-1,4-dione.
| Compound Name | 1-[4-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]piperazin-1-yl]-7-[2-(3-oxobutoxy)ethoxy]heptane-1,4-dione |
|---|---|
| PubChem CID | 165076394 |
| Molecular Formula | C33H48N6O5 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.37 |
| IUPAC Name | 1-[4-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]piperazin-1-yl]-7-[2-(3-oxobutoxy)ethoxy]heptane-1,4-dione |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCN1CCN(C(=O)CCC(=O)CCCOCCOCCC(C)=O)CC1 |
| InChI | InChI=1S/C33H48N6O5/c1-3-4-11-29-36-31-32(27-9-5-6-10-28(27)35-33(31)34)39(29)20-17-37-15-18-38(19-16-37)30(42)13-12-26(41)8-7-21-43-23-24-44-22-14-25(2)40/h5-6,9-10H,3-4,7-8,11-24H2,1-2H3,(H2,34,35) |
| InChIKey | NDOKYFOCEQYHMQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|