C58H72B4N8O22P2S2 — CID 165077028
CID 165077028 (PubChem CID 165077028) has the molecular formula C58H72B4N8O22P2S2 and a molecular weight of 1402.58 g/mol.
| Compound Name | CID 165077028 |
|---|---|
| PubChem CID | 165077028 |
| Molecular Formula | C58H72B4N8O22P2S2 |
| Molecular Weight | 1402.58 g/mol |
| Exact Mass | 1402.41 |
| IUPAC Name | — |
| SMILES | O=C=O.O=C=O.[B]P([B])O[C@@H]1C(N=[N+]=[N-])[C@@H](OC2C(C)O[C@H](O[C@@H]3C(COS(=O)(=O)NCc4ccccc4)O[C@H](OC4C(C)O[C@@H](C)C(C)[C@@H]4OCc4ccccc4)C(N=[N+]=[N-])[C@H]3OP([B])[B])C(C)[C@@H]2OCc2ccccc2)OC(COS(=O)(=O)NCc2ccccc2)[C@H]1OC |
| InChI | InChI=1S/C56H72B4N8O18P2S2.2CO2/c1-33-35(3)78-36(4)48(46(33)74-29-40-23-15-9-16-24-40)82-56-45(66-68-62)53(86-88(59)60)51(43(81-56)32-77-90(71,72)64-28-39-21-13-8-14-22-39)84-54-34(2)47(75-30-41-25-17-10-18-26-41)49(37(5)79-54)83-55-44(65-67-61)52(85-87(57)58)50(73-6)42(80-55)31-76-89(69,70)63-27-38-19-11-7-12-20-38;2*2-1-3/h7-26,33-37,42-56,63-64H,27-32H2,1-6H3;;/t33?,34?,35-,36?,37?,42?,43?,44?,45?,46-,47-,48?,49?,50+,51+,52+,53+,54+,55+,56+;;/m0../s1 |
| InChIKey | DMXCBZUWDWVMKC-RGYCDZTBSA-N |
| XLogP | 5.79 |
| TPSA | 387.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1402.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|