About CID 165077464
CID 165077464 (PubChem CID 165077464) has the molecular formula C12H30I2S-2
and a molecular weight of 460.25 g/mol.
Molecular Properties
| Compound Name | CID 165077464 |
| PubChem CID | 165077464 |
| Molecular Formula | C12H30I2S-2 |
| Molecular Weight | 460.25 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | — |
| SMILES | CC[I-](CC)(CC)S[I-](CC)(CC)CC |
| InChI | InChI=1S/C12H30I2S/c1-7-13(8-2,9-3)15-14(10-4,11-5)12-6/h7-12H2,1-6H3/q-2 |
| InChIKey | KUYSUFDKDOPOHN-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.25 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 165077464 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165077464?
The IUPAC name of CID 165077464 (CID 165077464) is not available.
What is the SMILES notation for CID 165077464?
The canonical SMILES for CID 165077464 is CC[I-](CC)(CC)S[I-](CC)(CC)CC.
What is the InChIKey of CID 165077464?
The InChIKey is KUYSUFDKDOPOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H30I2S/c1-7-13(8-2,9-3)15-14(10-4,11-5)12-6/h7-12H2,1-6H3/q-2.
What are the key properties of CID 165077464?
CID 165077464 has a molecular weight of 460.25 g/mol, XLogP of -2.01, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165077464 is sourced from PubChem (CID 165077464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).