C16H12F3N5O — CID 16508183
2-(5-phenyltetrazol-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 16508183) has the molecular formula C16H12F3N5O and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-(5-phenyltetrazol-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-phenyltetrazol-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16508183 |
| Molecular Formula | C16H12F3N5O |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(5-phenyltetrazol-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N5O/c17-16(18,19)12-8-4-5-9-13(12)20-14(25)10-24-22-15(21-23-24)11-6-2-1-3-7-11/h1-9H,10H2,(H,20,25) |
| InChIKey | MXWDXPHXFBSRAR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |