C17H14F3N5O — CID 1169430
2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 1169430) has the molecular formula C17H14F3N5O and a molecular weight of 361.33 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1169430 |
| Molecular Formula | C17H14F3N5O |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(-c2nnn(CC(=O)Nc3ccccc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H14F3N5O/c1-11-6-8-12(9-7-11)16-22-24-25(23-16)10-15(26)21-14-5-3-2-4-13(14)17(18,19)20/h2-9H,10H2,1H3,(H,21,26) |
| InChIKey | KTWKQFCTKOTAKY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |