C15H12ClN3 — CID 165083752
4-chloro-6,7-dimethyl-2-pyridin-4-ylquinazoline (PubChem CID 165083752) has the molecular formula C15H12ClN3 and a molecular weight of 269.74 g/mol. Its IUPAC name is 4-chloro-6,7-dimethyl-2-pyridin-4-ylquinazoline.
| Compound Name | 4-chloro-6,7-dimethyl-2-pyridin-4-ylquinazoline |
|---|---|
| PubChem CID | 165083752 |
| Molecular Formula | C15H12ClN3 |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 4-chloro-6,7-dimethyl-2-pyridin-4-ylquinazoline |
| SMILES | Cc1cc2nc(-c3ccncc3)nc(Cl)c2cc1C |
| InChI | InChI=1S/C15H12ClN3/c1-9-7-12-13(8-10(9)2)18-15(19-14(12)16)11-3-5-17-6-4-11/h3-8H,1-2H3 |
| InChIKey | ZBAOJMAFLYQOMJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |