C10H18FNO3 — CID 165084162
N-[(3S,5S)-6-ethyl-5-fluoro-2-hydroxy-4-methyloxan-3-yl]acetamide (PubChem CID 165084162) has the molecular formula C10H18FNO3 and a molecular weight of 219.26 g/mol. Its IUPAC name is N-[(3S,5S)-6-ethyl-5-fluoro-2-hydroxy-4-methyloxan-3-yl]acetamide.
| Compound Name | N-[(3S,5S)-6-ethyl-5-fluoro-2-hydroxy-4-methyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 165084162 |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[(3S,5S)-6-ethyl-5-fluoro-2-hydroxy-4-methyloxan-3-yl]acetamide |
| SMILES | CCC1OC(O)[C@@H](NC(C)=O)C(C)[C@@H]1F |
| InChI | InChI=1S/C10H18FNO3/c1-4-7-8(11)5(2)9(10(14)15-7)12-6(3)13/h5,7-10,14H,4H2,1-3H3,(H,12,13)/t5?,7?,8-,9-,10?/m0/s1 |
| InChIKey | VPLPOOZIVBGHNR-RRGHXVLVSA-N |
| XLogP | 0.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |