About (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate
(6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate (PubChem CID 165084433) has the molecular formula C19H16F2N2O3
and a molecular weight of 358.34 g/mol. Its IUPAC name is (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate |
| PubChem CID | 165084433 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc2ccc(F)cc2[nH]1.OCc1cc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C10H8FNO2.C9H8FNO/c1-14-10(13)9-4-6-2-3-7(11)5-8(6)12-9;10-7-2-1-6-3-8(5-12)11-9(6)4-7/h2-5,12H,1H3;1-4,11-12H,5H2 |
| InChIKey | VQNBPOOGHUTFFR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate?
The IUPAC name of (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate (CID 165084433) is (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate.
What is the SMILES notation for (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate?
The canonical SMILES for (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate is COC(=O)c1cc2ccc(F)cc2[nH]1.OCc1cc2ccc(F)cc2[nH]1.
What is the InChIKey of (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate?
The InChIKey is VQNBPOOGHUTFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO2.C9H8FNO/c1-14-10(13)9-4-6-2-3-7(11)5-8(6)12-9;10-7-2-1-6-3-8(5-12)11-9(6)4-7/h2-5,12H,1H3;1-4,11-12H,5H2.
What are the key properties of (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate?
(6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate has a molecular weight of 358.34 g/mol, XLogP of 3.89, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-1H-indol-2-yl)methanol;methyl 6-fluoro-1H-indole-2-carboxylate is sourced from PubChem (CID 165084433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).