C30H31F6N3O2 — CID 165085969
2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid (PubChem CID 165085969) has the molecular formula C30H31F6N3O2 and a molecular weight of 579.59 g/mol. Its IUPAC name is 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 165085969 |
| Molecular Formula | C30H31F6N3O2 |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid |
| SMILES | Cc1cc(CN2CCN(Cc3ccncc3)[C@@H](CC(=O)O)C2)ccc1-c1ccc(C(C)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H31F6N3O2/c1-20-15-22(17-38-13-14-39(25(19-38)16-27(40)41)18-21-9-11-37-12-10-21)3-8-26(20)23-4-6-24(7-5-23)28(2,29(31,32)33)30(34,35)36/h3-12,15,25H,13-14,16-19H2,1-2H3,(H,40,41)/t25-/m0/s1 |
| InChIKey | APUJBOJGAIJLBA-VWLOTQADSA-N |
| XLogP | 6.60 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |