C33H37F6N3O4 — CID 134465442
2-ethoxyethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate (PubChem CID 134465442) has the molecular formula C33H37F6N3O4 and a molecular weight of 653.66 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate.
| Compound Name | 2-ethoxyethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 134465442 |
| Molecular Formula | C33H37F6N3O4 |
| Molecular Weight | 653.66 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | 2-ethoxyethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
| SMILES | CCOCCOC(=O)CC1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c(C)c2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C33H37F6N3O4/c1-3-45-16-17-46-30(43)19-28-22-41(14-15-42(28)21-24-10-12-40-13-11-24)20-25-4-9-29(23(2)18-25)26-5-7-27(8-6-26)31(44,32(34,35)36)33(37,38)39/h4-13,18,28,44H,3,14-17,19-22H2,1-2H3 |
| InChIKey | ICZILNPDEZWIPF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.66 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|