C33H37F6N3O3 — CID 134465399
ethyl 3-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]-2-methylbutanoate (PubChem CID 134465399) has the molecular formula C33H37F6N3O3 and a molecular weight of 637.67 g/mol. Its IUPAC name is ethyl 3-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]-2-methylbutanoate.
| Compound Name | ethyl 3-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]-2-methylbutanoate |
|---|---|
| PubChem CID | 134465399 |
| Molecular Formula | C33H37F6N3O3 |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | ethyl 3-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)C(C)C1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C33H37F6N3O3/c1-4-45-30(43)23(3)22(2)29-21-41(17-18-42(29)20-25-13-15-40-16-14-25)19-24-5-7-26(8-6-24)27-9-11-28(12-10-27)31(44,32(34,35)36)33(37,38)39/h5-16,22-23,29,44H,4,17-21H2,1-3H3 |
| InChIKey | IPHYGBHIOGIRNA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |