C29H30F6N4O3 — CID 134465459
2-aminoethyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazine-2-carboxylate (PubChem CID 134465459) has the molecular formula C29H30F6N4O3 and a molecular weight of 596.57 g/mol. Its IUPAC name is 2-aminoethyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazine-2-carboxylate.
| Compound Name | 2-aminoethyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 134465459 |
| Molecular Formula | C29H30F6N4O3 |
| Molecular Weight | 596.57 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2-aminoethyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazine-2-carboxylate |
| SMILES | NCCOC(=O)[C@H]1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C29H30F6N4O3/c30-28(31,32)27(41,29(33,34)35)24-7-5-23(6-8-24)22-3-1-20(2-4-22)17-38-14-15-39(18-21-9-12-37-13-10-21)25(19-38)26(40)42-16-11-36/h1-10,12-13,25,41H,11,14-19,36H2/t25-/m1/s1 |
| InChIKey | WCLWSSDBBJCBFS-RUZDIDTESA-N |
| XLogP | 4.25 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |