C30H33F6N5O2 — CID 167098644
N-(2-aminoethyl)-2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetamide (PubChem CID 167098644) has the molecular formula C30H33F6N5O2 and a molecular weight of 609.62 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 167098644 |
| Molecular Formula | C30H33F6N5O2 |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | N-(2-aminoethyl)-2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetamide |
| SMILES | NCCNC(=O)CC1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C30H33F6N5O2/c31-29(32,33)28(43,30(34,35)36)25-7-5-24(6-8-25)23-3-1-21(2-4-23)18-40-15-16-41(19-22-9-12-38-13-10-22)26(20-40)17-27(42)39-14-11-37/h1-10,12-13,26,43H,11,14-20,37H2,(H,39,42) |
| InChIKey | CSXGPMXXNSKARM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |