C23H21N5O2S — CID 16508637
N-(3-methoxyphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide (PubChem CID 16508637) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 16508637 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide |
| SMILES | COc1cccc(NC(=O)C(Sc2nnnn2-c2ccccc2C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21N5O2S/c1-16-9-6-7-14-20(16)28-23(25-26-27-28)31-21(17-10-4-3-5-11-17)22(29)24-18-12-8-13-19(15-18)30-2/h3-15,21H,1-2H3,(H,24,29) |
| InChIKey | IFLDNZQFETWQOK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |