C22H18FN5OS — CID 2505071
(2R)-N-(4-fluorophenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide (PubChem CID 2505071) has the molecular formula C22H18FN5OS and a molecular weight of 419.49 g/mol. Its IUPAC name is (2R)-N-(4-fluorophenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide.
| Compound Name | (2R)-N-(4-fluorophenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 2505071 |
| Molecular Formula | C22H18FN5OS |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2R)-N-(4-fluorophenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetamide |
| SMILES | Cc1ccccc1-n1nnnc1S[C@@H](C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18FN5OS/c1-15-7-5-6-10-19(15)28-22(25-26-27-28)30-20(16-8-3-2-4-9-16)21(29)24-18-13-11-17(23)12-14-18/h2-14,20H,1H3,(H,24,29)/t20-/m1/s1 |
| InChIKey | BTRDNLRFFOWTSO-HXUWFJFHSA-N |
| XLogP | 4.58 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |