C18H20NO2S2- — CID 165091848
N-[3-[4-(3-methylphenyl)-2-sulfanylidenebutyl]phenyl]methanesulfonimidate (PubChem CID 165091848) has the molecular formula C18H20NO2S2- and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[3-[4-(3-methylphenyl)-2-sulfanylidenebutyl]phenyl]methanesulfonimidate.
| Compound Name | N-[3-[4-(3-methylphenyl)-2-sulfanylidenebutyl]phenyl]methanesulfonimidate |
|---|---|
| PubChem CID | 165091848 |
| Molecular Formula | C18H20NO2S2- |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[3-[4-(3-methylphenyl)-2-sulfanylidenebutyl]phenyl]methanesulfonimidate |
| SMILES | Cc1cccc(CCC(=S)Cc2cccc(N=S(C)(=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H21NO2S2/c1-14-5-3-6-15(11-14)9-10-18(22)13-16-7-4-8-17(12-16)19-23(2,20)21/h3-8,11-12H,9-10,13H2,1-2H3,(H,19,20,21)/p-1 |
| InChIKey | WVOPQVTVGIHUGU-UHFFFAOYSA-M |
| XLogP | 4.40 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|