C17H30N6 — CID 165095228
N'-[N'-[4-(2-aminoethyl)-6-methylcyclohexa-1,3-dien-1-yl]carbamimidoyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 165095228) has the molecular formula C17H30N6 and a molecular weight of 318.47 g/mol. Its IUPAC name is N'-[N'-[4-(2-aminoethyl)-6-methylcyclohexa-1,3-dien-1-yl]carbamimidoyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[N'-[4-(2-aminoethyl)-6-methylcyclohexa-1,3-dien-1-yl]carbamimidoyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 165095228 |
| Molecular Formula | C17H30N6 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | N'-[N'-[4-(2-aminoethyl)-6-methylcyclohexa-1,3-dien-1-yl]carbamimidoyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(C(N)=N/C(N)=N/C2=CC=C(CCN)CC2C)CC1 |
| InChI | InChI=1S/C17H30N6/c1-12-6-9-23(10-7-12)17(20)22-16(19)21-15-4-3-14(5-8-18)11-13(15)2/h3-4,12-13H,5-11,18H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | XJSBDRSXIJNBRB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|