C17H28N4 — CID 163418877
3-[[(3R)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-1-yl]methyl]-5-methyl-4H-pyrimidin-6-amine (PubChem CID 163418877) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-[[(3R)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-1-yl]methyl]-5-methyl-4H-pyrimidin-6-amine.
| Compound Name | 3-[[(3R)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-1-yl]methyl]-5-methyl-4H-pyrimidin-6-amine |
|---|---|
| PubChem CID | 163418877 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 3-[[(3R)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-1-yl]methyl]-5-methyl-4H-pyrimidin-6-amine |
| SMILES | C/C=C\C(=C/C)[C@H]1CCCN(CN2C=NC(N)=C(C)C2)C1 |
| InChI | InChI=1S/C17H28N4/c1-4-7-15(5-2)16-8-6-9-20(11-16)13-21-10-14(3)17(18)19-12-21/h4-5,7,12,16H,6,8-11,13,18H2,1-3H3/b7-4-,15-5+/t16-/m0/s1 |
| InChIKey | AGTFLVSRXLGAPW-FIYXNWLASA-N |
| XLogP | 2.71 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|