C14H25N3 — CID 122096896
N'-(cyclohexen-1-ylmethyl)-3-methylpiperidine-1-carboximidamide (PubChem CID 122096896) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N'-(cyclohexen-1-ylmethyl)-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-(cyclohexen-1-ylmethyl)-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 122096896 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N'-(cyclohexen-1-ylmethyl)-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CC2=CCCCC2)C1 |
| InChI | InChI=1S/C14H25N3/c1-12-6-5-9-17(11-12)14(15)16-10-13-7-3-2-4-8-13/h7,12H,2-6,8-11H2,1H3,(H2,15,16) |
| InChIKey | BQGMJGYGYVEIMX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|