C38H19BN4 — CID 165098027
4-(13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2(33),3,5,7,9,11,14,16,18(31),20,22,24,26,28,30(32)-pentadecaen-16-yl)-3-isocyanobenzonitrile (PubChem CID 165098027) has the molecular formula C38H19BN4 and a molecular weight of 542.41 g/mol. Its IUPAC name is 4-(13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2(33),3,5,7,9,11,14,16,18(31),20,22,24,26,28,30(32)-pentadecaen-16-yl)-3-isocyanobenzonitrile.
| Compound Name | 4-(13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2(33),3,5,7,9,11,14,16,18(31),20,22,24,26,28,30(32)-pentadecaen-16-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 165098027 |
| Molecular Formula | C38H19BN4 |
| Molecular Weight | 542.41 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 4-(13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2(33),3,5,7,9,11,14,16,18(31),20,22,24,26,28,30(32)-pentadecaen-16-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)ccc1-c1cc2c3c(c1)-n1c4ccccc4c4cccc(c41)B3c1cccc3c4ccccc4n-2c13 |
| InChI | InChI=1S/C38H19BN4/c1-41-31-18-22(21-40)16-17-24(31)23-19-34-36-35(20-23)43-33-15-5-3-9-26(33)28-11-7-13-30(38(28)43)39(36)29-12-6-10-27-25-8-2-4-14-32(25)42(34)37(27)29/h2-20H |
| InChIKey | OUYXPXCFCZUSGC-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.41 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|