C38H21BN4 — CID 165068165
3-isocyano-4-(21-phenyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9,11,13(27),15,17,19,22,24-dodecaen-24-yl)benzonitrile (PubChem CID 165068165) has the molecular formula C38H21BN4 and a molecular weight of 544.43 g/mol. Its IUPAC name is 3-isocyano-4-(21-phenyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9,11,13(27),15,17,19,22,24-dodecaen-24-yl)benzonitrile.
| Compound Name | 3-isocyano-4-(21-phenyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9,11,13(27),15,17,19,22,24-dodecaen-24-yl)benzonitrile |
|---|---|
| PubChem CID | 165068165 |
| Molecular Formula | C38H21BN4 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 3-isocyano-4-(21-phenyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3,5,7,9,11,13(27),15,17,19,22,24-dodecaen-24-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)ccc1-c1cc2c3c(c1)-n1c4ccccc4c4cccc(c41)B3c1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C38H21BN4/c1-41-32-20-24(23-40)18-19-27(32)25-21-35-37-36(22-25)43-33-16-7-5-12-28(33)29-13-9-15-31(38(29)43)39(37)30-14-6-8-17-34(30)42(35)26-10-3-2-4-11-26/h2-22H |
| InChIKey | UDGBNDHJXXKJKR-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|