C38H23BN4 — CID 164971850
2-(8,14-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-3-isocyanobenzonitrile (PubChem CID 164971850) has the molecular formula C38H23BN4 and a molecular weight of 546.44 g/mol. Its IUPAC name is 2-(8,14-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-3-isocyanobenzonitrile.
| Compound Name | 2-(8,14-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 164971850 |
| Molecular Formula | C38H23BN4 |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 2-(8,14-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1cc2c3c(c1)N(c1ccccc1)c1ccccc1B3c1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C38H23BN4/c1-41-32-20-12-13-26(25-40)37(32)27-23-35-38-36(24-27)43(29-16-6-3-7-17-29)34-22-11-9-19-31(34)39(38)30-18-8-10-21-33(30)42(35)28-14-4-2-5-15-28/h2-24H |
| InChIKey | KIEYJZLJPBMUHJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|