C5H10O15S4 — CID 165100193
[2-oxo-2-(sulfomethoxy)-1-(sulfomethoxysulfonyl)ethoxy]methanesulfonic acid (PubChem CID 165100193) has the molecular formula C5H10O15S4 and a molecular weight of 438.39 g/mol. Its IUPAC name is [2-oxo-2-(sulfomethoxy)-1-(sulfomethoxysulfonyl)ethoxy]methanesulfonic acid.
| Compound Name | [2-oxo-2-(sulfomethoxy)-1-(sulfomethoxysulfonyl)ethoxy]methanesulfonic acid |
|---|---|
| PubChem CID | 165100193 |
| Molecular Formula | C5H10O15S4 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.89 |
| IUPAC Name | [2-oxo-2-(sulfomethoxy)-1-(sulfomethoxysulfonyl)ethoxy]methanesulfonic acid |
| SMILES | O=C(OCS(=O)(=O)O)C(OCS(=O)(=O)O)S(=O)(=O)OCS(=O)(=O)O |
| InChI | InChI=1S/C5H10O15S4/c6-4(18-1-21(7,8)9)5(19-2-22(10,11)12)24(16,17)20-3-23(13,14)15/h5H,1-3H2,(H,7,8,9)(H,10,11,12)(H,13,14,15) |
| InChIKey | KCZAQMYIBRJIPZ-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 242.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|