C27H42O3 — CID 165103950
[(8R,9S,10R,13S,14S,17S)-16-methyl-3-oxo-10,13,17-tris(trideuteriomethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] hexanoate (PubChem CID 165103950) has the molecular formula C27H42O3 and a molecular weight of 423.68 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-16-methyl-3-oxo-10,13,17-tris(trideuteriomethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] hexanoate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-16-methyl-3-oxo-10,13,17-tris(trideuteriomethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] hexanoate |
|---|---|
| PubChem CID | 165103950 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.37 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-16-methyl-3-oxo-10,13,17-tris(trideuteriomethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] hexanoate |
| SMILES | [2H]C([2H])([2H])[C@]1(OC(=O)CCCCC)C(C)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C([2H])([2H])[2H])[C@H]3CC[C@@]21C([2H])([2H])[2H] |
| InChI | InChI=1S/C27H42O3/c1-6-7-8-9-24(29)30-27(5)18(2)16-23-21-11-10-19-17-20(28)12-14-25(19,3)22(21)13-15-26(23,27)4/h17-18,21-23H,6-16H2,1-5H3/t18?,21-,22+,23+,25+,26+,27+/m1/s1/i3D3,4D3,5D3 |
| InChIKey | LYMZEDKJIFKXRZ-VDZNVONISA-N |
| XLogP | 6.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|