C16H28N2O3 — CID 165109302
(2S)-2-methyl-2-prop-2-enylmorpholine;(2S)-2-methyl-2-prop-2-enylmorpholin-3-one (PubChem CID 165109302) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S)-2-methyl-2-prop-2-enylmorpholine;(2S)-2-methyl-2-prop-2-enylmorpholin-3-one.
| Compound Name | (2S)-2-methyl-2-prop-2-enylmorpholine;(2S)-2-methyl-2-prop-2-enylmorpholin-3-one |
|---|---|
| PubChem CID | 165109302 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (2S)-2-methyl-2-prop-2-enylmorpholine;(2S)-2-methyl-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CC[C@@]1(C)CNCCO1.C=CC[C@]1(C)OCCNC1=O |
| InChI | InChI=1S/C8H13NO2.C8H15NO/c1-3-4-8(2)7(10)9-5-6-11-8;1-3-4-8(2)7-9-5-6-10-8/h3H,1,4-6H2,2H3,(H,9,10);3,9H,1,4-7H2,2H3/t2*8-/m00/s1 |
| InChIKey | ZRIBQRWFQKYICT-GRHHLOCNSA-N |
| XLogP | 1.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|