C21H19N3O3S2 — CID 16510952
2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 16510952) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 16510952 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(NC(=O)CSc1nc2ccccc2c(=O)n1Cc1ccco1)c1cccs1 |
| InChI | InChI=1S/C21H19N3O3S2/c1-14(18-9-5-11-28-18)22-19(25)13-29-21-23-17-8-3-2-7-16(17)20(26)24(21)12-15-6-4-10-27-15/h2-11,14H,12-13H2,1H3,(H,22,25) |
| InChIKey | OQHQDVHXLOIPAG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |