C14H16F3N2O6P — CID 165111160
ethoxy-[2-(2-hydroxyethyl)cinnolin-2-ium-4-yl]phosphinic acid;2,2,2-trifluoroacetate (PubChem CID 165111160) has the molecular formula C14H16F3N2O6P and a molecular weight of 396.26 g/mol. Its IUPAC name is ethoxy-[2-(2-hydroxyethyl)cinnolin-2-ium-4-yl]phosphinic acid;2,2,2-trifluoroacetate.
| Compound Name | ethoxy-[2-(2-hydroxyethyl)cinnolin-2-ium-4-yl]phosphinic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165111160 |
| Molecular Formula | C14H16F3N2O6P |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | ethoxy-[2-(2-hydroxyethyl)cinnolin-2-ium-4-yl]phosphinic acid;2,2,2-trifluoroacetate |
| SMILES | CCOP(=O)(O)c1c[n+](CCO)nc2ccccc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H15N2O4P.C2HF3O2/c1-2-18-19(16,17)12-9-14(7-8-15)13-11-6-4-3-5-10(11)12;3-2(4,5)1(6)7/h3-6,9,15H,2,7-8H2,1H3;(H,6,7) |
| InChIKey | HASQTMIECKZNLY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|