C21H18N6O — CID 165112472
2-[5-[3-(1-methylindazol-6-yl)phenyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile (PubChem CID 165112472) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-[5-[3-(1-methylindazol-6-yl)phenyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile.
| Compound Name | 2-[5-[3-(1-methylindazol-6-yl)phenyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 165112472 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[5-[3-(1-methylindazol-6-yl)phenyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile |
| SMILES | Cn1ncc2ccc(-c3cccc(-c4nc(C5CCCN5C#N)no4)c3)cc21 |
| InChI | InChI=1S/C21H18N6O/c1-26-19-11-15(7-8-17(19)12-23-26)14-4-2-5-16(10-14)21-24-20(25-28-21)18-6-3-9-27(18)13-22/h2,4-5,7-8,10-12,18H,3,6,9H2,1H3 |
| InChIKey | JNEDJQIKMHMEGB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|