C23H18F6N4O3 — CID 57391213
methyl 5-[5-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indazol-2-yl]pentanoate (PubChem CID 57391213) has the molecular formula C23H18F6N4O3 and a molecular weight of 512.41 g/mol. Its IUPAC name is methyl 5-[5-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indazol-2-yl]pentanoate.
| Compound Name | methyl 5-[5-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indazol-2-yl]pentanoate |
|---|---|
| PubChem CID | 57391213 |
| Molecular Formula | C23H18F6N4O3 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | methyl 5-[5-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indazol-2-yl]pentanoate |
| SMILES | COC(=O)CCCCn1cc2cc(-c3noc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)n3)ccc2n1 |
| InChI | InChI=1S/C23H18F6N4O3/c1-35-19(34)4-2-3-7-33-12-15-8-13(5-6-18(15)31-33)20-30-21(36-32-20)14-9-16(22(24,25)26)11-17(10-14)23(27,28)29/h5-6,8-12H,2-4,7H2,1H3 |
| InChIKey | QGGSIZFGJHSTNA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|