C22H25IN6O2 — CID 165113010
5-iodo-N-[4-[(7-morpholin-4-yl-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrimidin-2-amine (PubChem CID 165113010) has the molecular formula C22H25IN6O2 and a molecular weight of 532.39 g/mol. Its IUPAC name is 5-iodo-N-[4-[(7-morpholin-4-yl-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrimidin-2-amine.
| Compound Name | 5-iodo-N-[4-[(7-morpholin-4-yl-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 165113010 |
| Molecular Formula | C22H25IN6O2 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 5-iodo-N-[4-[(7-morpholin-4-yl-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrimidin-2-amine |
| SMILES | Ic1cnc(NC2CCC(Oc3nc(N4CCOCC4)cc4ncccc34)CC2)nc1 |
| InChI | InChI=1S/C22H25IN6O2/c23-15-13-25-22(26-14-15)27-16-3-5-17(6-4-16)31-21-18-2-1-7-24-19(18)12-20(28-21)29-8-10-30-11-9-29/h1-2,7,12-14,16-17H,3-6,8-11H2,(H,25,26,27) |
| InChIKey | CXIPCXNIAKSRJS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|