C30H34N8O6S — CID 165113032
N-[7-morpholin-4-yl-5-[4-(pyrimidin-2-ylamino)cyclohexyl]oxy-1,6-naphthyridin-3-yl]-N-[(4-nitrophenyl)methyl]methanesulfonamide (PubChem CID 165113032) has the molecular formula C30H34N8O6S and a molecular weight of 634.72 g/mol. Its IUPAC name is N-[7-morpholin-4-yl-5-[4-(pyrimidin-2-ylamino)cyclohexyl]oxy-1,6-naphthyridin-3-yl]-N-[(4-nitrophenyl)methyl]methanesulfonamide.
| Compound Name | N-[7-morpholin-4-yl-5-[4-(pyrimidin-2-ylamino)cyclohexyl]oxy-1,6-naphthyridin-3-yl]-N-[(4-nitrophenyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 165113032 |
| Molecular Formula | C30H34N8O6S |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | N-[7-morpholin-4-yl-5-[4-(pyrimidin-2-ylamino)cyclohexyl]oxy-1,6-naphthyridin-3-yl]-N-[(4-nitrophenyl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc([N+](=O)[O-])cc1)c1cnc2cc(N3CCOCC3)nc(OC3CCC(Nc4ncccn4)CC3)c2c1 |
| InChI | InChI=1S/C30H34N8O6S/c1-45(41,42)37(20-21-3-7-23(8-4-21)38(39)40)24-17-26-27(33-19-24)18-28(36-13-15-43-16-14-36)35-29(26)44-25-9-5-22(6-10-25)34-30-31-11-2-12-32-30/h2-4,7-8,11-12,17-19,22,25H,5-6,9-10,13-16,20H2,1H3,(H,31,32,34) |
| InChIKey | CACSNMSPOPIYCW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 165.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|