C29H36N10O6S — CID 165112999
N-[(3-methyl-2-nitroimidazol-4-yl)methyl]-N-[7-morpholin-4-yl-5-[[4-(pyrimidin-2-ylamino)cyclohexyl]methoxy]-1,6-naphthyridin-3-yl]methanesulfonamide (PubChem CID 165112999) has the molecular formula C29H36N10O6S and a molecular weight of 652.74 g/mol. Its IUPAC name is N-[(3-methyl-2-nitroimidazol-4-yl)methyl]-N-[7-morpholin-4-yl-5-[[4-(pyrimidin-2-ylamino)cyclohexyl]methoxy]-1,6-naphthyridin-3-yl]methanesulfonamide.
| Compound Name | N-[(3-methyl-2-nitroimidazol-4-yl)methyl]-N-[7-morpholin-4-yl-5-[[4-(pyrimidin-2-ylamino)cyclohexyl]methoxy]-1,6-naphthyridin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 165112999 |
| Molecular Formula | C29H36N10O6S |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | N-[(3-methyl-2-nitroimidazol-4-yl)methyl]-N-[7-morpholin-4-yl-5-[[4-(pyrimidin-2-ylamino)cyclohexyl]methoxy]-1,6-naphthyridin-3-yl]methanesulfonamide |
| SMILES | Cn1c(CN(c2cnc3cc(N4CCOCC4)nc(OCC4CCC(Nc5ncccn5)CC4)c3c2)S(C)(=O)=O)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H36N10O6S/c1-36-23(17-33-29(36)39(40)41)18-38(46(2,42)43)22-14-24-25(32-16-22)15-26(37-10-12-44-13-11-37)35-27(24)45-19-20-4-6-21(7-5-20)34-28-30-8-3-9-31-28/h3,8-9,14-17,20-21H,4-7,10-13,18-19H2,1-2H3,(H,30,31,34) |
| InChIKey | YOLGGJQVDWEINR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 183.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|