C29H32N10O5 — CID 165113482
6-methyl-2-[[4-[[3-[(3-methyl-2-nitroimidazol-4-yl)methoxy]-7-morpholin-4-yl-1,6-naphthyridin-5-yl]oxy]cyclohexyl]amino]pyrimidine-4-carbonitrile (PubChem CID 165113482) has the molecular formula C29H32N10O5 and a molecular weight of 600.64 g/mol. Its IUPAC name is 6-methyl-2-[[4-[[3-[(3-methyl-2-nitroimidazol-4-yl)methoxy]-7-morpholin-4-yl-1,6-naphthyridin-5-yl]oxy]cyclohexyl]amino]pyrimidine-4-carbonitrile.
| Compound Name | 6-methyl-2-[[4-[[3-[(3-methyl-2-nitroimidazol-4-yl)methoxy]-7-morpholin-4-yl-1,6-naphthyridin-5-yl]oxy]cyclohexyl]amino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 165113482 |
| Molecular Formula | C29H32N10O5 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 6-methyl-2-[[4-[[3-[(3-methyl-2-nitroimidazol-4-yl)methoxy]-7-morpholin-4-yl-1,6-naphthyridin-5-yl]oxy]cyclohexyl]amino]pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NC2CCC(Oc3nc(N4CCOCC4)cc4ncc(OCc5cnc([N+](=O)[O-])n5C)cc34)CC2)n1 |
| InChI | InChI=1S/C29H32N10O5/c1-18-11-20(14-30)35-28(33-18)34-19-3-5-22(6-4-19)44-27-24-12-23(43-17-21-15-32-29(37(21)2)39(40)41)16-31-25(24)13-26(36-27)38-7-9-42-10-8-38/h11-13,15-16,19,22H,3-10,17H2,1-2H3,(H,33,34,35) |
| InChIKey | BSAYJUKBZDJNTR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 179.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|