C31H39N9O4 — CID 175633276
N-[5-[1-[[5-[4-[(4,6-dimethylpyrimidin-2-yl)amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide (PubChem CID 175633276) has the molecular formula C31H39N9O4 and a molecular weight of 601.71 g/mol. Its IUPAC name is N-[5-[1-[[5-[4-[(4,6-dimethylpyrimidin-2-yl)amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide.
| Compound Name | N-[5-[1-[[5-[4-[(4,6-dimethylpyrimidin-2-yl)amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide |
|---|---|
| PubChem CID | 175633276 |
| Molecular Formula | C31H39N9O4 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | N-[5-[1-[[5-[4-[(4,6-dimethylpyrimidin-2-yl)amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide |
| SMILES | C=[N+]([O-])c1ncc(C(C)Oc2cnc3cc(N4CCOCC4)nc(OC4CCC(Nc5nc(C)cc(C)n5)CC4)c3c2)n1C |
| InChI | InChI=1S/C31H39N9O4/c1-19-14-20(2)35-30(34-19)36-22-6-8-23(9-7-22)44-29-25-15-24(43-21(3)27-18-33-31(38(27)4)39(5)41)17-32-26(25)16-28(37-29)40-10-12-42-13-11-40/h14-18,21-23H,5-13H2,1-4H3,(H,34,35,36) |
| InChIKey | NEUKMHRNUMMAKN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|