C33H44N10O5 — CID 175633268
N-[5-[1-[[5-[4-[[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide (PubChem CID 175633268) has the molecular formula C33H44N10O5 and a molecular weight of 660.78 g/mol. Its IUPAC name is N-[5-[1-[[5-[4-[[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide.
| Compound Name | N-[5-[1-[[5-[4-[[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide |
|---|---|
| PubChem CID | 175633268 |
| Molecular Formula | C33H44N10O5 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | N-[5-[1-[[5-[4-[[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy]ethyl]-1-methylimidazol-2-yl]methanimine oxide |
| SMILES | C=[N+]([O-])c1ncc(C(C)Oc2cnc3cc(N4CCOCC4)nc(OC4CCC(Nc5ncc(OCCN(C)C)cn5)CC4)c3c2)n1C |
| InChI | InChI=1S/C33H44N10O5/c1-22(29-21-37-33(41(29)4)42(5)44)47-25-16-27-28(34-18-25)17-30(43-11-13-45-14-12-43)39-31(27)48-24-8-6-23(7-9-24)38-32-35-19-26(20-36-32)46-15-10-40(2)3/h16-24H,5-15H2,1-4H3,(H,35,36,38) |
| InChIKey | SIILMOBUAZWAEV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|