C31H47N7O6SSi — CID 165113612
N-[5-[4-[[5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]methanesulfonamide (PubChem CID 165113612) has the molecular formula C31H47N7O6SSi and a molecular weight of 673.91 g/mol. Its IUPAC name is N-[5-[4-[[5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]methanesulfonamide.
| Compound Name | N-[5-[4-[[5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 165113612 |
| Molecular Formula | C31H47N7O6SSi |
| Molecular Weight | 673.91 g/mol |
| Exact Mass | 673.31 |
| IUPAC Name | N-[5-[4-[[5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-yl]amino]cyclohexyl]oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]methanesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1cnc(NC2CCC(Oc3nc(N4CCOCC4)cc4ncc(NS(C)(=O)=O)cc34)CC2)nc1 |
| InChI | InChI=1S/C31H47N7O6SSi/c1-31(2,3)46(5,6)43-16-15-42-25-20-33-30(34-21-25)35-22-7-9-24(10-8-22)44-29-26-17-23(37-45(4,39)40)19-32-27(26)18-28(36-29)38-11-13-41-14-12-38/h17-22,24,37H,7-16H2,1-6H3,(H,33,34,35) |
| InChIKey | AUDDKKSLCYHAPV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.91 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|