C26H31N5O3 — CID 165113562
4-[5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]-2-methylbut-3-yn-2-ol (PubChem CID 165113562) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-[5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 165113562 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 4-[5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1cnc2cc(N3CCOCC3)nc(OC3CCC(n4ccnc4)CC3)c2c1 |
| InChI | InChI=1S/C26H31N5O3/c1-26(2,32)8-7-19-15-22-23(28-17-19)16-24(30-11-13-33-14-12-30)29-25(22)34-21-5-3-20(4-6-21)31-10-9-27-18-31/h9-10,15-18,20-21,32H,3-6,11-14H2,1-2H3 |
| InChIKey | CTCYFNKITFRYJS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|