C28H34N8O7 — CID 156649362
[5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy-(3-nitro-1-propan-2-ylpyrazol-4-yl)methanediol (PubChem CID 156649362) has the molecular formula C28H34N8O7 and a molecular weight of 594.63 g/mol. Its IUPAC name is [5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy-(3-nitro-1-propan-2-ylpyrazol-4-yl)methanediol.
| Compound Name | [5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy-(3-nitro-1-propan-2-ylpyrazol-4-yl)methanediol |
|---|---|
| PubChem CID | 156649362 |
| Molecular Formula | C28H34N8O7 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | [5-(4-imidazol-1-ylcyclohexyl)oxy-7-morpholin-4-yl-1,6-naphthyridin-3-yl]oxy-(3-nitro-1-propan-2-ylpyrazol-4-yl)methanediol |
| SMILES | CC(C)n1cc(C(O)(O)Oc2cnc3cc(N4CCOCC4)nc(OC4CCC(n5ccnc5)CC4)c3c2)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C28H34N8O7/c1-18(2)35-16-23(26(32-35)36(39)40)28(37,38)43-21-13-22-24(30-15-21)14-25(33-9-11-41-12-10-33)31-27(22)42-20-5-3-19(4-6-20)34-8-7-29-17-34/h7-8,13-20,37-38H,3-6,9-12H2,1-2H3 |
| InChIKey | RQOQKRLMVPZAFU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 175.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|