About 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde
2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde (PubChem CID 165116549) has the molecular formula C19H39N3O
and a molecular weight of 325.54 g/mol. Its IUPAC name is 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde |
| PubChem CID | 165116549 |
| Molecular Formula | C19H39N3O |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.31 |
| IUPAC Name | 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde |
| SMILES | CC(C)C.CC(C)CN1CCN(CC2CCN(C=O)CC2)CC1 |
| InChI | InChI=1S/C15H29N3O.C4H10/c1-14(2)11-16-7-9-17(10-8-16)12-15-3-5-18(13-19)6-4-15;1-4(2)3/h13-15H,3-12H2,1-2H3;4H,1-3H3 |
| InChIKey | GHVOFKSPPABMFZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
The IUPAC name of 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde (CID 165116549) is 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde.
What is the SMILES notation for 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
The canonical SMILES for 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde is CC(C)C.CC(C)CN1CCN(CC2CCN(C=O)CC2)CC1.
What is the InChIKey of 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
The InChIKey is GHVOFKSPPABMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O.C4H10/c1-14(2)11-16-7-9-17(10-8-16)12-15-3-5-18(13-19)6-4-15;1-4(2)3/h13-15H,3-12H2,1-2H3;4H,1-3H3.
What are the key properties of 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde has a molecular weight of 325.54 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde is sourced from PubChem (CID 165116549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).