C15H27F2N3O — CID 176558507
4-[[3,3-difluoro-1-(2-methylpropyl)piperidin-4-yl]methyl]piperazine-1-carbaldehyde (PubChem CID 176558507) has the molecular formula C15H27F2N3O and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-[[3,3-difluoro-1-(2-methylpropyl)piperidin-4-yl]methyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[[3,3-difluoro-1-(2-methylpropyl)piperidin-4-yl]methyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 176558507 |
| Molecular Formula | C15H27F2N3O |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 4-[[3,3-difluoro-1-(2-methylpropyl)piperidin-4-yl]methyl]piperazine-1-carbaldehyde |
| SMILES | CC(C)CN1CCC(CN2CCN(C=O)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C15H27F2N3O/c1-13(2)9-20-4-3-14(15(16,17)11-20)10-18-5-7-19(12-21)8-6-18/h12-14H,3-11H2,1-2H3 |
| InChIKey | OTAQDXJRNLRWKT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|